C20H37NO4 — CID 129206915
(5-methyl-2-propan-2-ylcyclohexyl) 9-nitrosononyl carbonate (PubChem CID 129206915) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 9-nitrosononyl carbonate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 9-nitrosononyl carbonate |
|---|---|
| PubChem CID | 129206915 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 9-nitrosononyl carbonate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)OCCCCCCCCCN=O)C1 |
| InChI | InChI=1S/C20H37NO4/c1-16(2)18-12-11-17(3)15-19(18)25-20(22)24-14-10-8-6-4-5-7-9-13-21-23/h16-19H,4-15H2,1-3H3 |
| InChIKey | MOSJPTQFAIJXEU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|