C23H42O4 — CID 90706756
[2-(9-hydroxynonyl)cyclopropyl] (5-methyl-2-propan-2-ylcyclohexyl) carbonate (PubChem CID 90706756) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is [2-(9-hydroxynonyl)cyclopropyl] (5-methyl-2-propan-2-ylcyclohexyl) carbonate.
| Compound Name | [2-(9-hydroxynonyl)cyclopropyl] (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 90706756 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | [2-(9-hydroxynonyl)cyclopropyl] (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)OC2CC2CCCCCCCCCO)C1 |
| InChI | InChI=1S/C23H42O4/c1-17(2)20-13-12-18(3)15-22(20)27-23(25)26-21-16-19(21)11-9-7-5-4-6-8-10-14-24/h17-22,24H,4-16H2,1-3H3 |
| InChIKey | ZMEKHISYHRQCPD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|