C20H42NO+ — CID 122512054
heptyl-dimethyl-[[(5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium (PubChem CID 122512054) has the molecular formula C20H42NO+ and a molecular weight of 312.56 g/mol. Its IUPAC name is heptyl-dimethyl-[[(5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium.
| Compound Name | heptyl-dimethyl-[[(5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium |
|---|---|
| PubChem CID | 122512054 |
| Molecular Formula | C20H42NO+ |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | heptyl-dimethyl-[[(5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium |
| SMILES | CCCCCCC[N+](C)(C)COC1C[C@H](C)CCC1C(C)C |
| InChI | InChI=1S/C20H42NO/c1-7-8-9-10-11-14-21(5,6)16-22-20-15-18(4)12-13-19(20)17(2)3/h17-20H,7-16H2,1-6H3/q+1/t18-,19?,20?/m1/s1 |
| InChIKey | AFLOMAFUALAARC-XEVCZEQESA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|