C23H48NO+ — CID 11675486
decyl-dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium (PubChem CID 11675486) has the molecular formula C23H48NO+ and a molecular weight of 354.64 g/mol. Its IUPAC name is decyl-dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium.
| Compound Name | decyl-dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium |
|---|---|
| PubChem CID | 11675486 |
| Molecular Formula | C23H48NO+ |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.37 |
| IUPAC Name | decyl-dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]azanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CO[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C23H48NO/c1-7-8-9-10-11-12-13-14-17-24(5,6)19-25-23-18-21(4)15-16-22(23)20(2)3/h20-23H,7-19H2,1-6H3/q+1/t21-,22+,23-/m1/s1 |
| InChIKey | LIFKDWFUGYQXQA-XPWALMASSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|