C25H47N2O2+ — CID 52921240
1-(decoxymethyl)-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium (PubChem CID 52921240) has the molecular formula C25H47N2O2+ and a molecular weight of 407.66 g/mol. Its IUPAC name is 1-(decoxymethyl)-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium.
| Compound Name | 1-(decoxymethyl)-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 52921240 |
| Molecular Formula | C25H47N2O2+ |
| Molecular Weight | 407.66 g/mol |
| Exact Mass | 407.36 |
| IUPAC Name | 1-(decoxymethyl)-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium |
| SMILES | CCCCCCCCCCOC[n+]1ccn(CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1 |
| InChI | InChI=1S/C25H47N2O2/c1-5-6-7-8-9-10-11-12-17-28-20-26-15-16-27(19-26)21-29-25-18-23(4)13-14-24(25)22(2)3/h15-16,19,22-25H,5-14,17-18,20-21H2,1-4H3/q+1/t23-,24+,25-/m1/s1 |
| InChIKey | UGQAQFVEXSNZFF-DSNGMDLFSA-N |
| XLogP | 6.33 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|