C24H45ClN2O2 — CID 52921237
1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(nonoxymethyl)imidazol-3-ium chloride (PubChem CID 52921237) has the molecular formula C24H45ClN2O2 and a molecular weight of 429.09 g/mol. Its IUPAC name is 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(nonoxymethyl)imidazol-3-ium chloride.
| Compound Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(nonoxymethyl)imidazol-3-ium chloride |
|---|---|
| PubChem CID | 52921237 |
| Molecular Formula | C24H45ClN2O2 |
| Molecular Weight | 429.09 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(nonoxymethyl)imidazol-3-ium chloride |
| SMILES | CCCCCCCCCOC[n+]1ccn(CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1.[Cl-] |
| InChI | InChI=1S/C24H45N2O2.ClH/c1-5-6-7-8-9-10-11-16-27-19-25-14-15-26(18-25)20-28-24-17-22(4)12-13-23(24)21(2)3;/h14-15,18,21-24H,5-13,16-17,19-20H2,1-4H3;1H/q+1;/p-1/t22-,23+,24-;/m1./s1 |
| InChIKey | KBOCMAQGYFGDAW-SJUVJREQSA-M |
| XLogP | 2.94 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|