C22H41ClN2O — CID 16681499
1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-octylimidazol-1-ium chloride (PubChem CID 16681499) has the molecular formula C22H41ClN2O and a molecular weight of 385.04 g/mol. Its IUPAC name is 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-octylimidazol-1-ium chloride.
| Compound Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-octylimidazol-1-ium chloride |
|---|---|
| PubChem CID | 16681499 |
| Molecular Formula | C22H41ClN2O |
| Molecular Weight | 385.04 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-octylimidazol-1-ium chloride |
| SMILES | CCCCCCCCn1cc[n+](CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1.[Cl-] |
| InChI | InChI=1S/C22H41N2O.ClH/c1-5-6-7-8-9-10-13-23-14-15-24(17-23)18-25-22-16-20(4)11-12-21(22)19(2)3;/h14-15,17,19-22H,5-13,16,18H2,1-4H3;1H/q+1;/p-1/t20-,21+,22-;/m1./s1 |
| InChIKey | IDXFINNLOGHMQI-IVFOJYRASA-M |
| XLogP | 2.58 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.04 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|