C13H31N2O2Si3+ — CID 123856025
[dimethyl(trimethylsilyloxy)silyl]oxy-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane (PubChem CID 123856025) has the molecular formula C13H31N2O2Si3+ and a molecular weight of 331.66 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 123856025 |
| Molecular Formula | C13H31N2O2Si3+ |
| Molecular Weight | 331.66 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane |
| SMILES | CCn1cc[n+](C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C13H31N2O2Si3/c1-9-14-10-11-15(12-14)13-19(5,6)17-20(7,8)16-18(2,3)4/h10-12H,9,13H2,1-8H3/q+1 |
| InChIKey | JTONSIRJIZGTGW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|