C11H15N2+ — CID 139239035
1-(cyclopenta-1,3-dien-1-ylmethyl)-3-ethylimidazol-1-ium (PubChem CID 139239035) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-(cyclopenta-1,3-dien-1-ylmethyl)-3-ethylimidazol-1-ium.
| Compound Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)-3-ethylimidazol-1-ium |
|---|---|
| PubChem CID | 139239035 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)-3-ethylimidazol-1-ium |
| SMILES | CCn1cc[n+](CC2=CC=CC2)c1 |
| InChI | InChI=1S/C11H15N2/c1-2-12-7-8-13(10-12)9-11-5-3-4-6-11/h3-5,7-8,10H,2,6,9H2,1H3/q+1 |
| InChIKey | WOGRUABURYECQT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|