C11H12N+ — CID 13271537
1-(cyclopenta-1,3-dien-1-ylmethyl)pyridin-1-ium (PubChem CID 13271537) has the molecular formula C11H12N+ and a molecular weight of 158.22 g/mol. Its IUPAC name is 1-(cyclopenta-1,3-dien-1-ylmethyl)pyridin-1-ium.
| Compound Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 13271537 |
| Molecular Formula | C11H12N+ |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.10 |
| IUPAC Name | 1-(cyclopenta-1,3-dien-1-ylmethyl)pyridin-1-ium |
| SMILES | C1=CCC(C[n+]2ccccc2)=C1 |
| InChI | InChI=1S/C11H12N/c1-4-8-12(9-5-1)10-11-6-2-3-7-11/h1-6,8-9H,7,10H2/q+1 |
| InChIKey | KASKSMMEBPJFNE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|