C23H35N4P+2 — CID 142611553
butane;[3-[(3-ethenylimidazol-1-ium-1-yl)methyl]-5-[(3-ethylimidazol-1-ium-1-yl)methyl]phenyl]methylphosphane (PubChem CID 142611553) has the molecular formula C23H35N4P+2 and a molecular weight of 398.54 g/mol. Its IUPAC name is butane;[3-[(3-ethenylimidazol-1-ium-1-yl)methyl]-5-[(3-ethylimidazol-1-ium-1-yl)methyl]phenyl]methylphosphane.
| Compound Name | butane;[3-[(3-ethenylimidazol-1-ium-1-yl)methyl]-5-[(3-ethylimidazol-1-ium-1-yl)methyl]phenyl]methylphosphane |
|---|---|
| PubChem CID | 142611553 |
| Molecular Formula | C23H35N4P+2 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | butane;[3-[(3-ethenylimidazol-1-ium-1-yl)methyl]-5-[(3-ethylimidazol-1-ium-1-yl)methyl]phenyl]methylphosphane |
| SMILES | C=Cn1cc[n+](Cc2cc(CP)cc(C[n+]3ccn(CC)c3)c2)c1.CCCC |
| InChI | InChI=1S/C19H25N4P.C4H10/c1-3-20-5-7-22(15-20)12-17-9-18(11-19(10-17)14-24)13-23-8-6-21(4-2)16-23;1-3-4-2/h3,5-11,15-16H,1,4,12-14,24H2,2H3;3-4H2,1-2H3/q+2; |
| InChIKey | IVQSTMLMAMBWFL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|