About propylsulfonyl propane-1-sulfonate
propylsulfonyl propane-1-sulfonate (PubChem CID 11031687) has the molecular formula C6H14O5S2
and a molecular weight of 230.31 g/mol. Its IUPAC name is propylsulfonyl propane-1-sulfonate.
Molecular Properties
| Compound Name | propylsulfonyl propane-1-sulfonate |
| PubChem CID | 11031687 |
| Molecular Formula | C6H14O5S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | propylsulfonyl propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(=O)(=O)CCC |
| InChI | InChI=1S/C6H14O5S2/c1-3-5-12(7,8)11-13(9,10)6-4-2/h3-6H2,1-2H3 |
| InChIKey | OTRCLINFKXQIBG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propylsulfonyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylsulfonyl propane-1-sulfonate?
The IUPAC name of propylsulfonyl propane-1-sulfonate (CID 11031687) is propylsulfonyl propane-1-sulfonate.
What is the SMILES notation for propylsulfonyl propane-1-sulfonate?
The canonical SMILES for propylsulfonyl propane-1-sulfonate is CCCS(=O)(=O)OS(=O)(=O)CCC.
What is the InChIKey of propylsulfonyl propane-1-sulfonate?
The InChIKey is OTRCLINFKXQIBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O5S2/c1-3-5-12(7,8)11-13(9,10)6-4-2/h3-6H2,1-2H3.
What are the key properties of propylsulfonyl propane-1-sulfonate?
propylsulfonyl propane-1-sulfonate has a molecular weight of 230.31 g/mol, XLogP of 0.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propylsulfonyl propane-1-sulfonate is sourced from PubChem (CID 11031687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).