About 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate
2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate (PubChem CID 56974207) has the molecular formula C8H17NO6S2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate.
Molecular Properties
| Compound Name | 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate |
| PubChem CID | 56974207 |
| Molecular Formula | C8H17NO6S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(=O)(=O)C/C=N/CC(C)O |
| InChI | InChI=1S/C8H17NO6S2/c1-3-5-16(11,12)15-17(13,14)6-4-9-7-8(2)10/h4,8,10H,3,5-7H2,1-2H3/b9-4+ |
| InChIKey | ZNNRZFAIFRWWFG-RUDMXATFSA-N |
| XLogP | -0.48 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate?
The IUPAC name of 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate (CID 56974207) is 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate.
What is the SMILES notation for 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate?
The canonical SMILES for 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate is CCCS(=O)(=O)OS(=O)(=O)C/C=N/CC(C)O.
What is the InChIKey of 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate?
The InChIKey is ZNNRZFAIFRWWFG-RUDMXATFSA-N. The full InChI is InChI=1S/C8H17NO6S2/c1-3-5-16(11,12)15-17(13,14)6-4-9-7-8(2)10/h4,8,10H,3,5-7H2,1-2H3/b9-4+.
What are the key properties of 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate?
2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate has a molecular weight of 287.36 g/mol, XLogP of -0.48, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxypropylimino)ethylsulfonyl propane-1-sulfonate is sourced from PubChem (CID 56974207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).