About acetic acid;propylsulfonyl propane-1-sulfonate
acetic acid;propylsulfonyl propane-1-sulfonate (PubChem CID 146345923) has the molecular formula C8H18O7S2
and a molecular weight of 290.36 g/mol. Its IUPAC name is acetic acid;propylsulfonyl propane-1-sulfonate.
Molecular Properties
| Compound Name | acetic acid;propylsulfonyl propane-1-sulfonate |
| PubChem CID | 146345923 |
| Molecular Formula | C8H18O7S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | acetic acid;propylsulfonyl propane-1-sulfonate |
| SMILES | CC(=O)O.CCCS(=O)(=O)OS(=O)(=O)CCC |
| InChI | InChI=1S/C6H14O5S2.C2H4O2/c1-3-5-12(7,8)11-13(9,10)6-4-2;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4) |
| InChIKey | APERBQOLPFMFMG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;propylsulfonyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;propylsulfonyl propane-1-sulfonate?
The IUPAC name of acetic acid;propylsulfonyl propane-1-sulfonate (CID 146345923) is acetic acid;propylsulfonyl propane-1-sulfonate.
What is the SMILES notation for acetic acid;propylsulfonyl propane-1-sulfonate?
The canonical SMILES for acetic acid;propylsulfonyl propane-1-sulfonate is CC(=O)O.CCCS(=O)(=O)OS(=O)(=O)CCC.
What is the InChIKey of acetic acid;propylsulfonyl propane-1-sulfonate?
The InChIKey is APERBQOLPFMFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O5S2.C2H4O2/c1-3-5-12(7,8)11-13(9,10)6-4-2;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;propylsulfonyl propane-1-sulfonate?
acetic acid;propylsulfonyl propane-1-sulfonate has a molecular weight of 290.36 g/mol, XLogP of 0.57, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;propylsulfonyl propane-1-sulfonate is sourced from PubChem (CID 146345923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).