C24H40N2O4P2S2 — CID 145301695
4-butyl-N-diethylphosphanylbenzenesulfonamide;N-diethylphosphanylbenzenesulfonamide (PubChem CID 145301695) has the molecular formula C24H40N2O4P2S2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4-butyl-N-diethylphosphanylbenzenesulfonamide;N-diethylphosphanylbenzenesulfonamide.
| Compound Name | 4-butyl-N-diethylphosphanylbenzenesulfonamide;N-diethylphosphanylbenzenesulfonamide |
|---|---|
| PubChem CID | 145301695 |
| Molecular Formula | C24H40N2O4P2S2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-butyl-N-diethylphosphanylbenzenesulfonamide;N-diethylphosphanylbenzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)NP(CC)CC)cc1.CCP(CC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H24NO2PS.C10H16NO2PS/c1-4-7-8-13-9-11-14(12-10-13)19(16,17)15-18(5-2)6-3;1-3-14(4-2)11-15(12,13)10-8-6-5-7-9-10/h9-12,15H,4-8H2,1-3H3;5-9,11H,3-4H2,1-2H3 |
| InChIKey | SVQLWFBVCQXUOE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|