C37H50O5S2Si2 — CID 139709037
[phenyl-bis(3-triethylsilyloxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139709037) has the molecular formula C37H50O5S2Si2 and a molecular weight of 695.11 g/mol. Its IUPAC name is [phenyl-bis(3-triethylsilyloxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [phenyl-bis(3-triethylsilyloxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139709037 |
| Molecular Formula | C37H50O5S2Si2 |
| Molecular Weight | 695.11 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | [phenyl-bis(3-triethylsilyloxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | CC[Si](CC)(CC)Oc1cccc(S(OS(=O)(=O)c2ccc(C)cc2)(c2ccccc2)c2cccc(O[Si](CC)(CC)CC)c2)c1 |
| InChI | InChI=1S/C37H50O5S2Si2/c1-8-45(9-2,10-3)40-32-19-17-23-36(29-32)43(34-21-15-14-16-22-34,42-44(38,39)35-27-25-31(7)26-28-35)37-24-18-20-33(30-37)41-46(11-4,12-5)13-6/h14-30H,8-13H2,1-7H3 |
| InChIKey | DXXXTQCOMMBGET-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.11 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|