C26H22F2O4S2 — CID 139997928
[bis(4-fluorophenyl)-(4-methoxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139997928) has the molecular formula C26H22F2O4S2 and a molecular weight of 500.59 g/mol. Its IUPAC name is [bis(4-fluorophenyl)-(4-methoxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [bis(4-fluorophenyl)-(4-methoxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139997928 |
| Molecular Formula | C26H22F2O4S2 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | [bis(4-fluorophenyl)-(4-methoxyphenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)c2ccc(C)cc2)(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H22F2O4S2/c1-19-3-11-26(12-4-19)34(29,30)32-33(23-13-5-20(27)6-14-23,24-15-7-21(28)8-16-24)25-17-9-22(31-2)10-18-25/h3-18H,1-2H3 |
| InChIKey | ZDJRSPNPKCDVBV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |