C20H31N4O6S+ — CID 123322137
1-[4-cyclopropyl-5-(diazonioamino)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]sulfonyl-4-methylbenzene (PubChem CID 123322137) has the molecular formula C20H31N4O6S+ and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[4-cyclopropyl-5-(diazonioamino)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]sulfonyl-4-methylbenzene.
| Compound Name | 1-[4-cyclopropyl-5-(diazonioamino)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 123322137 |
| Molecular Formula | C20H31N4O6S+ |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-[4-cyclopropyl-5-(diazonioamino)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentoxy]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)OCC(NC(=O)OC(C)(C)C)C(O)C(CN[N+]#N)C2CC2)cc1 |
| InChI | InChI=1S/C20H30N4O6S/c1-13-5-9-15(10-6-13)31(27,28)29-12-17(23-19(26)30-20(2,3)4)18(25)16(11-22-24-21)14-7-8-14/h5-6,9-10,14,16-18,22,25H,7-8,11-12H2,1-4H3/p+1 |
| InChIKey | NDUWHKUHLVPXRY-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|