C19H30N6O8S — CID 131713882
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 131713882) has the molecular formula C19H30N6O8S and a molecular weight of 502.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 131713882 |
| Molecular Formula | C19H30N6O8S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C19H30N6O8S/c1-11-4-6-12(7-5-11)34(32,33)25-19(21)22-8-2-3-13(20)16(28)23-14(9-26)17(29)24-15(10-27)18(30)31/h4-7,13-15,26-27H,2-3,8-10,20H2,1H3,(H,23,28)(H,24,29)(H,30,31)(H3,21,22,25)/t13-,14-,15-/m0/s1 |
| InChIKey | LRLMHHUYRWGVBK-KKUMJFAQSA-N |
| XLogP | -3.27 |
| TPSA | 246.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|