C25H31N3O5 — CID 54117762
4-nitroso-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid (PubChem CID 54117762) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-nitroso-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid.
| Compound Name | 4-nitroso-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
|---|---|
| PubChem CID | 54117762 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-nitroso-4-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
| SMILES | CN1C(=O)N(CCC(CC(N=O)c2ccc3c(c2)CC2=C3CCCC2)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C25H31N3O5/c1-25(2)23(31)28(24(32)27(25)3)11-10-17(22(29)30)14-21(26-33)16-8-9-20-18(13-16)12-15-6-4-5-7-19(15)20/h8-9,13,17,21H,4-7,10-12,14H2,1-3H3,(H,29,30) |
| InChIKey | NLNXFNAZVWNAPL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|