C17H20N2O5S — CID 91571981
2-benzoyl-2-sulfanyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid (PubChem CID 91571981) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-benzoyl-2-sulfanyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid.
| Compound Name | 2-benzoyl-2-sulfanyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 91571981 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-benzoyl-2-sulfanyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoic acid |
| SMILES | CN1C(=O)N(CCC(S)(C(=O)O)C(=O)c2ccccc2)C(=O)C1(C)C |
| InChI | InChI=1S/C17H20N2O5S/c1-16(2)13(21)19(15(24)18(16)3)10-9-17(25,14(22)23)12(20)11-7-5-4-6-8-11/h4-8,25H,9-10H2,1-3H3,(H,22,23) |
| InChIKey | YETMUUHZQWUKGE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|