C23H30N2O3 — CID 126729135
1,5-dimethyl-5-[(1S,5R)-3-methyl-3-bicyclo[3.3.1]nonanyl]-3-phenacylimidazolidine-2,4-dione (PubChem CID 126729135) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1,5-dimethyl-5-[(1S,5R)-3-methyl-3-bicyclo[3.3.1]nonanyl]-3-phenacylimidazolidine-2,4-dione.
| Compound Name | 1,5-dimethyl-5-[(1S,5R)-3-methyl-3-bicyclo[3.3.1]nonanyl]-3-phenacylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126729135 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1,5-dimethyl-5-[(1S,5R)-3-methyl-3-bicyclo[3.3.1]nonanyl]-3-phenacylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)c2ccccc2)C(=O)C1(C)C1(C)C[C@@H]2CCC[C@@H](C2)C1 |
| InChI | InChI=1S/C23H30N2O3/c1-22(13-16-8-7-9-17(12-16)14-22)23(2)20(27)25(21(28)24(23)3)15-19(26)18-10-5-4-6-11-18/h4-6,10-11,16-17H,7-9,12-15H2,1-3H3/t16-,17+,22?,23? |
| InChIKey | DCSZNAFYDONOSP-WDXRGRCHSA-N |
| XLogP | 4.13 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|