C26H30N2O4 — CID 138510294
5-[2-(cyclohexylmethoxy)phenyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione (PubChem CID 138510294) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[2-(cyclohexylmethoxy)phenyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione.
| Compound Name | 5-[2-(cyclohexylmethoxy)phenyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510294 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-[2-(cyclohexylmethoxy)phenyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)c2ccccc2)C(=O)C1(C)c1ccccc1OCC1CCCCC1 |
| InChI | InChI=1S/C26H30N2O4/c1-26(21-15-9-10-16-23(21)32-18-19-11-5-3-6-12-19)24(30)28(25(31)27(26)2)17-22(29)20-13-7-4-8-14-20/h4,7-10,13-16,19H,3,5-6,11-12,17-18H2,1-2H3 |
| InChIKey | FPCHTVDSRIUUIP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|