C20H24N2O4 — CID 118599524
5-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 118599524) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118599524 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)c2cccc(O)c2)C(=O)C1(C)C1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C20H24N2O4/c1-20(16-9-12-6-7-13(16)8-12)18(25)22(19(26)21(20)2)11-17(24)14-4-3-5-15(23)10-14/h3-5,10,12-13,16,23H,6-9,11H2,1-2H3/t12-,13+,16?,20?/m1/s1 |
| InChIKey | JJSXVATYXKEOHT-SLQYCSHZSA-N |
| XLogP | 2.66 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|