C21H26N2O4 — CID 118599469
5-[(2S)-2-bicyclo[2.2.2]octanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 118599469) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[(2S)-2-bicyclo[2.2.2]octanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[(2S)-2-bicyclo[2.2.2]octanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118599469 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 5-[(2S)-2-bicyclo[2.2.2]octanyl]-3-[2-(3-hydroxyphenyl)-2-oxoethyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)c2cccc(O)c2)C(=O)C1(C)[C@H]1CC2CCC1CC2 |
| InChI | InChI=1S/C21H26N2O4/c1-21(17-10-13-6-8-14(17)9-7-13)19(26)23(20(27)22(21)2)12-18(25)15-4-3-5-16(24)11-15/h3-5,11,13-14,17,24H,6-10,12H2,1-2H3/t13?,14?,17-,21?/m0/s1 |
| InChIKey | KVONWYISVWDPAS-QRWIOAOZSA-N |
| XLogP | 3.05 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|