C24H30BrN3O5 — CID 11168358
(2R)-2-bromo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoate;[(1R,2S)-2-hydroxy-1,2-diphenylethyl]azanium (PubChem CID 11168358) has the molecular formula C24H30BrN3O5 and a molecular weight of 520.42 g/mol. Its IUPAC name is (2R)-2-bromo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoate;[(1R,2S)-2-hydroxy-1,2-diphenylethyl]azanium.
| Compound Name | (2R)-2-bromo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoate;[(1R,2S)-2-hydroxy-1,2-diphenylethyl]azanium |
|---|---|
| PubChem CID | 11168358 |
| Molecular Formula | C24H30BrN3O5 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2R)-2-bromo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoate;[(1R,2S)-2-hydroxy-1,2-diphenylethyl]azanium |
| SMILES | CN1C(=O)N(CC[C@@H](Br)C(=O)[O-])C(=O)C1(C)C.[NH3+][C@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO.C10H15BrN2O4/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-10(2)8(16)13(9(17)12(10)3)5-4-6(11)7(14)15/h1-10,13-14,16H,15H2;6H,4-5H2,1-3H3,(H,14,15)/t13-,14+;6-/m11/s1 |
| InChIKey | CAYNCHJVSUZKSX-SJCVRGQTSA-N |
| XLogP | 1.27 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|