C24H28N2O5S — CID 70089603
(2S)-4-oxo-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid (PubChem CID 70089603) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is (2S)-4-oxo-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid.
| Compound Name | (2S)-4-oxo-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
|---|---|
| PubChem CID | 70089603 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2S)-4-oxo-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
| SMILES | CN1C(=O)N(CC[C@@H](CC(=O)c2ccc3c4c(sc3c2)CCCC4)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C24H28N2O5S/c1-24(2)22(30)26(23(31)25(24)3)11-10-15(21(28)29)12-18(27)14-8-9-17-16-6-4-5-7-19(16)32-20(17)13-14/h8-9,13,15H,4-7,10-12H2,1-3H3,(H,28,29)/t15-/m0/s1 |
| InChIKey | GYKAHDMWHFUZSM-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|