C13H17BrO3 — CID 177493381
methyl (2R)-5-bromo-2-[(R)-hydroxy(phenyl)methyl]pentanoate (PubChem CID 177493381) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is methyl (2R)-5-bromo-2-[(R)-hydroxy(phenyl)methyl]pentanoate.
| Compound Name | methyl (2R)-5-bromo-2-[(R)-hydroxy(phenyl)methyl]pentanoate |
|---|---|
| PubChem CID | 177493381 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | methyl (2R)-5-bromo-2-[(R)-hydroxy(phenyl)methyl]pentanoate |
| SMILES | COC(=O)[C@H](CCCBr)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H17BrO3/c1-17-13(16)11(8-5-9-14)12(15)10-6-3-2-4-7-10/h2-4,6-7,11-12,15H,5,8-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | XTYDBPYKRGPNLU-NEPJUHHUSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|