C20H28N2O8S — CID 18459334
2-[(4-butoxyphenyl)sulfonylmethyl]-2-hydroxy-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (PubChem CID 18459334) has the molecular formula C20H28N2O8S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-[(4-butoxyphenyl)sulfonylmethyl]-2-hydroxy-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid.
| Compound Name | 2-[(4-butoxyphenyl)sulfonylmethyl]-2-hydroxy-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 18459334 |
| Molecular Formula | C20H28N2O8S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[(4-butoxyphenyl)sulfonylmethyl]-2-hydroxy-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)CC(O)(CN2C(=O)N(C)C(C)(C)C2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H28N2O8S/c1-5-6-11-30-14-7-9-15(10-8-14)31(28,29)13-20(27,17(24)25)12-22-16(23)19(2,3)21(4)18(22)26/h7-10,27H,5-6,11-13H2,1-4H3,(H,24,25) |
| InChIKey | RNUCINGVVQFHCM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|