C18H25N3O8S — CID 18459333
2-[(4-butoxyphenyl)sulfonylmethyl]-N,2-dihydroxy-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 18459333) has the molecular formula C18H25N3O8S and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[(4-butoxyphenyl)sulfonylmethyl]-N,2-dihydroxy-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | 2-[(4-butoxyphenyl)sulfonylmethyl]-N,2-dihydroxy-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 18459333 |
| Molecular Formula | C18H25N3O8S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[(4-butoxyphenyl)sulfonylmethyl]-N,2-dihydroxy-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)CC(O)(CN2C(=O)CN(C)C2=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C18H25N3O8S/c1-3-4-9-29-13-5-7-14(8-6-13)30(27,28)12-18(25,16(23)19-26)11-21-15(22)10-20(2)17(21)24/h5-8,25-26H,3-4,9-12H2,1-2H3,(H,19,23) |
| InChIKey | NJUXXAIBGYUSOX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|