C27H38N2O6S — CID 57402753
(2S)-2-(4-butoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanamide (PubChem CID 57402753) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is (2S)-2-(4-butoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanamide.
| Compound Name | (2S)-2-(4-butoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 57402753 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2S)-2-(4-butoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)[C@@](C)(Cc2ccc(OCCN3CCCCC3)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C27H38N2O6S/c1-3-4-19-34-24-12-14-25(15-13-24)36(32,33)27(2,26(30)28-31)21-22-8-10-23(11-9-22)35-20-18-29-16-6-5-7-17-29/h8-15,31H,3-7,16-21H2,1-2H3,(H,28,30)/t27-/m0/s1 |
| InChIKey | IOUQKHPLPLPITI-MHZLTWQESA-N |
| XLogP | 4.01 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|