C22H30N2O6S — CID 70128416
amino 2-methyl-2-(2-methylfuran-3-yl)sulfonyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanoate (PubChem CID 70128416) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is amino 2-methyl-2-(2-methylfuran-3-yl)sulfonyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanoate.
| Compound Name | amino 2-methyl-2-(2-methylfuran-3-yl)sulfonyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 70128416 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | amino 2-methyl-2-(2-methylfuran-3-yl)sulfonyl-3-[4-(2-piperidin-1-ylethoxy)phenyl]propanoate |
| SMILES | Cc1occc1S(=O)(=O)C(C)(Cc1ccc(OCCN2CCCCC2)cc1)C(=O)ON |
| InChI | InChI=1S/C22H30N2O6S/c1-17-20(10-14-28-17)31(26,27)22(2,21(25)30-23)16-18-6-8-19(9-7-18)29-15-13-24-11-4-3-5-12-24/h6-10,14H,3-5,11-13,15-16,23H2,1-2H3 |
| InChIKey | CATJTGGZHNLXDH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|