C26H36N2O6S — CID 45357244
2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]propanamide (PubChem CID 45357244) has the molecular formula C26H36N2O6S and a molecular weight of 504.65 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]propanamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 45357244 |
| Molecular Formula | C26H36N2O6S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)C(C)(Cc2ccc(OCCCN3CCCCC3)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C26H36N2O6S/c1-3-33-22-12-14-24(15-13-22)35(31,32)26(2,25(29)27-30)20-21-8-10-23(11-9-21)34-19-7-18-28-16-5-4-6-17-28/h8-15,30H,3-7,16-20H2,1-2H3,(H,27,29) |
| InChIKey | XIWBATQDQYFBOH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|