C24H34N2O6S — CID 18431233
3-[4-[1-(diethylamino)ethoxy]phenyl]-2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methylpropanamide (PubChem CID 18431233) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is 3-[4-[1-(diethylamino)ethoxy]phenyl]-2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methylpropanamide.
| Compound Name | 3-[4-[1-(diethylamino)ethoxy]phenyl]-2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 18431233 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-[4-[1-(diethylamino)ethoxy]phenyl]-2-(4-ethoxyphenyl)sulfonyl-N-hydroxy-2-methylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)C(C)(Cc2ccc(OC(C)N(CC)CC)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C24H34N2O6S/c1-6-26(7-2)18(4)32-21-11-9-19(10-12-21)17-24(5,23(27)25-28)33(29,30)22-15-13-20(14-16-22)31-8-3/h9-16,18,28H,6-8,17H2,1-5H3,(H,25,27) |
| InChIKey | IQDBAEZTPBDPIG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|