C24H34N2O5S — CID 70155786
2-(4-ethoxyphenyl)sulfonyl-3-[4-[2-(ethylamino)butoxy]phenyl]-2-methylpropanamide (PubChem CID 70155786) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfonyl-3-[4-[2-(ethylamino)butoxy]phenyl]-2-methylpropanamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfonyl-3-[4-[2-(ethylamino)butoxy]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 70155786 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfonyl-3-[4-[2-(ethylamino)butoxy]phenyl]-2-methylpropanamide |
| SMILES | CCNC(CC)COc1ccc(CC(C)(C(N)=O)S(=O)(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C24H34N2O5S/c1-5-19(26-6-2)17-31-21-10-8-18(9-11-21)16-24(4,23(25)27)32(28,29)22-14-12-20(13-15-22)30-7-3/h8-15,19,26H,5-7,16-17H2,1-4H3,(H2,25,27) |
| InChIKey | PHLOUBMGCOQLSX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |