C16H21N3O5S2 — CID 88903428
2-[1-[(4-butoxyphenyl)sulfonylamino]ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 88903428) has the molecular formula C16H21N3O5S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[1-[(4-butoxyphenyl)sulfonylamino]ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[1-[(4-butoxyphenyl)sulfonylamino]ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 88903428 |
| Molecular Formula | C16H21N3O5S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[1-[(4-butoxyphenyl)sulfonylamino]ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC(C)c2ncc(C(=O)NO)s2)cc1 |
| InChI | InChI=1S/C16H21N3O5S2/c1-3-4-9-24-12-5-7-13(8-6-12)26(22,23)19-11(2)16-17-10-14(25-16)15(20)18-21/h5-8,10-11,19,21H,3-4,9H2,1-2H3,(H,18,20) |
| InChIKey | CMJOVLUQMYPABT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|