C16H26N2O4S2 — CID 54406297
2-[(4-butoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanethioamide (PubChem CID 54406297) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[(4-butoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanethioamide.
| Compound Name | 2-[(4-butoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanethioamide |
|---|---|
| PubChem CID | 54406297 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[(4-butoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanethioamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC(C(=S)NO)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O4S2/c1-5-6-11-22-12-7-9-13(10-8-12)24(20,21)18-14(15(23)17-19)16(2,3)4/h7-10,14,18-19H,5-6,11H2,1-4H3,(H,17,23) |
| InChIKey | VQXQKWRMMUDDGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|