C21H24ClN3O6S — CID 20689556
3-[(2S)-3-[4-(4-chlorophenoxy)phenyl]sulfonyl-2-(hydroxyamino)propyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 20689556) has the molecular formula C21H24ClN3O6S and a molecular weight of 481.96 g/mol. Its IUPAC name is 3-[(2S)-3-[4-(4-chlorophenoxy)phenyl]sulfonyl-2-(hydroxyamino)propyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-3-[4-(4-chlorophenoxy)phenyl]sulfonyl-2-(hydroxyamino)propyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 20689556 |
| Molecular Formula | C21H24ClN3O6S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-[(2S)-3-[4-(4-chlorophenoxy)phenyl]sulfonyl-2-(hydroxyamino)propyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(C[C@@H](CS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)NO)C(=O)C1(C)C |
| InChI | InChI=1S/C21H24ClN3O6S/c1-21(2)19(26)25(20(27)24(21)3)12-15(23-28)13-32(29,30)18-10-8-17(9-11-18)31-16-6-4-14(22)5-7-16/h4-11,15,23,28H,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | YYTLUYCIGDYAJY-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|