C18H21F3N2O5S — CID 11133842
N-[1-(dimethylamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]hydroxylamine (PubChem CID 11133842) has the molecular formula C18H21F3N2O5S and a molecular weight of 434.44 g/mol. Its IUPAC name is N-[1-(dimethylamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]hydroxylamine.
| Compound Name | N-[1-(dimethylamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 11133842 |
| Molecular Formula | C18H21F3N2O5S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[1-(dimethylamino)-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]hydroxylamine |
| SMILES | CN(C)CC(CS(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)NO |
| InChI | InChI=1S/C18H21F3N2O5S/c1-23(2)11-13(22-24)12-29(25,26)17-9-7-15(8-10-17)27-14-3-5-16(6-4-14)28-18(19,20)21/h3-10,13,22,24H,11-12H2,1-2H3 |
| InChIKey | XLDOCJBFKWGCJR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|