C21H22F3NO7S — CID 142859135
N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]formamide (PubChem CID 142859135) has the molecular formula C21H22F3NO7S and a molecular weight of 489.47 g/mol. Its IUPAC name is N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]formamide.
| Compound Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]formamide |
|---|---|
| PubChem CID | 142859135 |
| Molecular Formula | C21H22F3NO7S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]formamide |
| SMILES | CC1(C)OC[C@H]([C@@H](CS(=O)(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)NC=O)O1 |
| InChI | InChI=1S/C21H22F3NO7S/c1-20(2)29-11-19(32-20)18(25-13-26)12-33(27,28)17-9-7-15(8-10-17)30-14-3-5-16(6-4-14)31-21(22,23)24/h3-10,13,18-19H,11-12H2,1-2H3,(H,25,26)/t18-,19-/m1/s1 |
| InChIKey | PRMFMKGGAPAURI-RTBURBONSA-N |
| XLogP | 3.42 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|