C22H22F5NO7S — CID 177399835
N-[(1S)-2-[4-[difluoro-[4-(trifluoromethoxy)phenyl]methyl]phenyl]sulfonyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide (PubChem CID 177399835) has the molecular formula C22H22F5NO7S and a molecular weight of 539.48 g/mol. Its IUPAC name is N-[(1S)-2-[4-[difluoro-[4-(trifluoromethoxy)phenyl]methyl]phenyl]sulfonyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide.
| Compound Name | N-[(1S)-2-[4-[difluoro-[4-(trifluoromethoxy)phenyl]methyl]phenyl]sulfonyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 177399835 |
| Molecular Formula | C22H22F5NO7S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-[(1S)-2-[4-[difluoro-[4-(trifluoromethoxy)phenyl]methyl]phenyl]sulfonyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide |
| SMILES | CC1(C)OC[C@H]([C@@H](CS(=O)(=O)c2ccc(C(F)(F)c3ccc(OC(F)(F)F)cc3)cc2)N(O)C=O)O1 |
| InChI | InChI=1S/C22H22F5NO7S/c1-20(2)33-11-19(35-20)18(28(30)13-29)12-36(31,32)17-9-5-15(6-10-17)21(23,24)14-3-7-16(8-4-14)34-22(25,26)27/h3-10,13,18-19,30H,11-12H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | YCPWFWWLYHLUPK-RTBURBONSA-N |
| XLogP | 3.87 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|