C19H18F3NO6S — CID 70252945
[1-cyclopropyl-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]carbamic acid (PubChem CID 70252945) has the molecular formula C19H18F3NO6S and a molecular weight of 445.42 g/mol. Its IUPAC name is [1-cyclopropyl-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]carbamic acid.
| Compound Name | [1-cyclopropyl-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]carbamic acid |
|---|---|
| PubChem CID | 70252945 |
| Molecular Formula | C19H18F3NO6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [1-cyclopropyl-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]carbamic acid |
| SMILES | O=C(O)NC(CS(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C19H18F3NO6S/c20-19(21,22)29-15-5-3-13(4-6-15)28-14-7-9-16(10-8-14)30(26,27)11-17(12-1-2-12)23-18(24)25/h3-10,12,17,23H,1-2,11H2,(H,24,25) |
| InChIKey | IUSXOURVKFDWCW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |