C21H18F3NO6S2 — CID 10278697
N-hydroxy-N-[1-thiophen-2-yl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]formamide (PubChem CID 10278697) has the molecular formula C21H18F3NO6S2 and a molecular weight of 501.50 g/mol. Its IUPAC name is N-hydroxy-N-[1-thiophen-2-yl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]formamide.
| Compound Name | N-hydroxy-N-[1-thiophen-2-yl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]formamide |
|---|---|
| PubChem CID | 10278697 |
| Molecular Formula | C21H18F3NO6S2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | N-hydroxy-N-[1-thiophen-2-yl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpropan-2-yl]formamide |
| SMILES | O=CN(O)C(Cc1cccs1)CS(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F3NO6S2/c22-21(23,24)31-18-5-3-16(4-6-18)30-17-7-9-20(10-8-17)33(28,29)13-15(25(27)14-26)12-19-2-1-11-32-19/h1-11,14-15,27H,12-13H2 |
| InChIKey | XWRPQDZEZDTELS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|