C21H24F3NO8S — CID 58725689
N-[(1S)-2-[dihydroxy-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-λ4-sulfanyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide (PubChem CID 58725689) has the molecular formula C21H24F3NO8S and a molecular weight of 507.48 g/mol. Its IUPAC name is N-[(1S)-2-[dihydroxy-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-λ4-sulfanyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide.
| Compound Name | N-[(1S)-2-[dihydroxy-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-λ4-sulfanyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58725689 |
| Molecular Formula | C21H24F3NO8S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[(1S)-2-[dihydroxy-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-λ4-sulfanyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-N-hydroxyformamide |
| SMILES | CC1(C)OC[C@H]([C@@H](CS(O)(O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)N(O)C=O)O1 |
| InChI | InChI=1S/C21H24F3NO8S/c1-20(2)30-11-19(33-20)18(25(27)13-26)12-34(28,29)17-9-7-15(8-10-17)31-14-3-5-16(6-4-14)32-21(22,23)24/h3-10,13,18-19,27-29H,11-12H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | RBGQYVKWZWSJQQ-RTBURBONSA-N |
| XLogP | 4.85 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|