C20H23F3N2O7S2 — CID 11103365
N-[1-[(2S)-1-methylsulfonylpyrrolidin-2-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]hydroxylamine (PubChem CID 11103365) has the molecular formula C20H23F3N2O7S2 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-[1-[(2S)-1-methylsulfonylpyrrolidin-2-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]hydroxylamine.
| Compound Name | N-[1-[(2S)-1-methylsulfonylpyrrolidin-2-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]hydroxylamine |
|---|---|
| PubChem CID | 11103365 |
| Molecular Formula | C20H23F3N2O7S2 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | N-[1-[(2S)-1-methylsulfonylpyrrolidin-2-yl]-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylethyl]hydroxylamine |
| SMILES | CS(=O)(=O)N1CCC[C@H]1C(CS(=O)(=O)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)NO |
| InChI | InChI=1S/C20H23F3N2O7S2/c1-33(27,28)25-12-2-3-19(25)18(24-26)13-34(29,30)17-10-8-15(9-11-17)31-14-4-6-16(7-5-14)32-20(21,22)23/h4-11,18-19,24,26H,2-3,12-13H2,1H3/t18?,19-/m0/s1 |
| InChIKey | URCVGVFCWPGAMI-GGYWPGCISA-N |
| XLogP | 2.92 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|