C21H22ClN3O6S — CID 23505510
2-[[4-(4-chlorophenyl)phenyl]sulfonylmethyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypropanamide (PubChem CID 23505510) has the molecular formula C21H22ClN3O6S and a molecular weight of 479.94 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)phenyl]sulfonylmethyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypropanamide.
| Compound Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylmethyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23505510 |
| Molecular Formula | C21H22ClN3O6S |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylmethyl]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-hydroxypropanamide |
| SMILES | CC1(C)NC(=O)N(CC(CS(=O)(=O)c2ccc(-c3ccc(Cl)cc3)cc2)C(=O)NO)C1=O |
| InChI | InChI=1S/C21H22ClN3O6S/c1-21(2)19(27)25(20(28)23-21)11-15(18(26)24-29)12-32(30,31)17-9-5-14(6-10-17)13-3-7-16(22)8-4-13/h3-10,15,29H,11-12H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | FZNKPZCUWMPFMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|