C23H26ClN3O6S — CID 23505558
2-[(3-butyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxypropanamide (PubChem CID 23505558) has the molecular formula C23H26ClN3O6S and a molecular weight of 508.00 g/mol. Its IUPAC name is 2-[(3-butyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxypropanamide.
| Compound Name | 2-[(3-butyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23505558 |
| Molecular Formula | C23H26ClN3O6S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-[(3-butyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxypropanamide |
| SMILES | CCCCN1CC(=O)N(CC(CS(=O)(=O)c2ccc(-c3ccc(Cl)cc3)cc2)C(=O)NO)C1=O |
| InChI | InChI=1S/C23H26ClN3O6S/c1-2-3-12-26-14-21(28)27(23(26)30)13-18(22(29)25-31)15-34(32,33)20-10-6-17(7-11-20)16-4-8-19(24)9-5-16/h4-11,18,31H,2-3,12-15H2,1H3,(H,25,29) |
| InChIKey | JAYYNTPKNALULE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|