C15H19N3O7S — CID 59957311
N-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 59957311) has the molecular formula C15H19N3O7S and a molecular weight of 385.40 g/mol. Its IUPAC name is N-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 59957311 |
| Molecular Formula | C15H19N3O7S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]-3-(3-methyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)CC(CN2C(=O)CN(C)C2=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C15H19N3O7S/c1-17-8-13(19)18(15(17)21)7-10(14(20)16-22)9-26(23,24)12-5-3-11(25-2)4-6-12/h3-6,10,22H,7-9H2,1-2H3,(H,16,20) |
| InChIKey | MAMRODGQCKBZPM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|