C20H18BrNO8S — CID 58481897
[1-(4-bromophenyl)-2-(4-methoxyphenyl)sulfonylethyl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 58481897) has the molecular formula C20H18BrNO8S and a molecular weight of 512.33 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2-(4-methoxyphenyl)sulfonylethyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [1-(4-bromophenyl)-2-(4-methoxyphenyl)sulfonylethyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 58481897 |
| Molecular Formula | C20H18BrNO8S |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | [1-(4-bromophenyl)-2-(4-methoxyphenyl)sulfonylethyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | COc1ccc(S(=O)(=O)CC(OC(=O)ON2C(=O)CCC2=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H18BrNO8S/c1-28-15-6-8-16(9-7-15)31(26,27)12-17(13-2-4-14(21)5-3-13)29-20(25)30-22-18(23)10-11-19(22)24/h2-9,17H,10-12H2,1H3 |
| InChIKey | FRILFKXROGYSJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|