C23H32N2O9S — CID 118891118
[1-(benzenesulfonyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-2-yl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 118891118) has the molecular formula C23H32N2O9S and a molecular weight of 512.58 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-2-yl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [1-(benzenesulfonyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-2-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 118891118 |
| Molecular Formula | C23H32N2O9S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [1-(benzenesulfonyl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptan-2-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(CS(=O)(=O)c1ccccc1)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C23H32N2O9S/c1-23(2,3)33-21(28)24-15-9-5-6-10-17(16-35(30,31)18-11-7-4-8-12-18)32-22(29)34-25-19(26)13-14-20(25)27/h4,7-8,11-12,17H,5-6,9-10,13-16H2,1-3H3,(H,24,28) |
| InChIKey | KNAGKHVWJZGUSF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|